C12H3F6NO2 — CID 134617355
1,2,3,4,5-pentafluoro-6-(2-fluoro-3-nitrophenyl)benzene (PubChem CID 134617355) has the molecular formula C12H3F6NO2 and a molecular weight of 307.15 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-(2-fluoro-3-nitrophenyl)benzene.
| Compound Name | 1,2,3,4,5-pentafluoro-6-(2-fluoro-3-nitrophenyl)benzene |
|---|---|
| PubChem CID | 134617355 |
| Molecular Formula | C12H3F6NO2 |
| Molecular Weight | 307.15 g/mol |
| Exact Mass | 307.01 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-(2-fluoro-3-nitrophenyl)benzene |
| SMILES | O=[N+]([O-])c1cccc(-c2c(F)c(F)c(F)c(F)c2F)c1F |
| InChI | InChI=1S/C12H3F6NO2/c13-7-4(2-1-3-5(7)19(20)21)6-8(14)10(16)12(18)11(17)9(6)15/h1-3H |
| InChIKey | WSTGKBPLLHKYAD-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.15 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|