C18H13ClFNO2 — CID 177075922
1-[6-(2-chlorophenyl)cyclohexa-1,5-dien-1-yl]-2-fluoro-3-nitrobenzene (PubChem CID 177075922) has the molecular formula C18H13ClFNO2 and a molecular weight of 329.76 g/mol. Its IUPAC name is 1-[6-(2-chlorophenyl)cyclohexa-1,5-dien-1-yl]-2-fluoro-3-nitrobenzene.
| Compound Name | 1-[6-(2-chlorophenyl)cyclohexa-1,5-dien-1-yl]-2-fluoro-3-nitrobenzene |
|---|---|
| PubChem CID | 177075922 |
| Molecular Formula | C18H13ClFNO2 |
| Molecular Weight | 329.76 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | 1-[6-(2-chlorophenyl)cyclohexa-1,5-dien-1-yl]-2-fluoro-3-nitrobenzene |
| SMILES | O=[N+]([O-])c1cccc(C2=CCCC=C2c2ccccc2Cl)c1F |
| InChI | InChI=1S/C18H13ClFNO2/c19-16-10-4-3-8-14(16)12-6-1-2-7-13(12)15-9-5-11-17(18(15)20)21(22)23/h3-11H,1-2H2 |
| InChIKey | AWFJRSLWORGEDS-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.76 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|