C57H53ClF2N4O4 — CID 164961797
2-tert-butyl-6-[2-[2-(2-fluoro-3-nitrophenyl)phenyl]phenyl]aniline;2-tert-butyl-6-methylaniline;1-[2-(2-chlorophenyl)phenyl]-2-fluoro-3-nitrobenzene (PubChem CID 164961797) has the molecular formula C57H53ClF2N4O4 and a molecular weight of 931.52 g/mol. Its IUPAC name is 2-tert-butyl-6-[2-[2-(2-fluoro-3-nitrophenyl)phenyl]phenyl]aniline;2-tert-butyl-6-methylaniline;1-[2-(2-chlorophenyl)phenyl]-2-fluoro-3-nitrobenzene.
| Compound Name | 2-tert-butyl-6-[2-[2-(2-fluoro-3-nitrophenyl)phenyl]phenyl]aniline;2-tert-butyl-6-methylaniline;1-[2-(2-chlorophenyl)phenyl]-2-fluoro-3-nitrobenzene |
|---|---|
| PubChem CID | 164961797 |
| Molecular Formula | C57H53ClF2N4O4 |
| Molecular Weight | 931.52 g/mol |
| Exact Mass | 930.37 |
| IUPAC Name | 2-tert-butyl-6-[2-[2-(2-fluoro-3-nitrophenyl)phenyl]phenyl]aniline;2-tert-butyl-6-methylaniline;1-[2-(2-chlorophenyl)phenyl]-2-fluoro-3-nitrobenzene |
| SMILES | CC(C)(C)c1cccc(-c2ccccc2-c2ccccc2-c2cccc([N+](=O)[O-])c2F)c1N.Cc1cccc(C(C)(C)C)c1N.O=[N+]([O-])c1cccc(-c2ccccc2-c2ccccc2Cl)c1F |
| InChI | InChI=1S/C28H25FN2O2.C18H11ClFNO2.C11H17N/c1-28(2,3)24-16-8-15-23(27(24)30)21-13-7-5-11-19(21)18-10-4-6-12-20(18)22-14-9-17-25(26(22)29)31(32)33;19-16-10-4-3-8-14(16)12-6-1-2-7-13(12)15-9-5-11-17(18(15)20)21(22)23;1-8-6-5-7-9(10(8)12)11(2,3)4/h4-17H,30H2,1-3H3;1-11H;5-7H,12H2,1-4H3 |
| InChIKey | BYBVDESFOCQXMH-UHFFFAOYSA-N |
| XLogP | 16.21 |
| TPSA | 138.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 931.52 |
| LogP ≤ 5 | 16.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|