C11H9NO4 — CID 121219341
5-(2-nitrophenyl)-2,3-dihydropyran-6-one (PubChem CID 121219341) has the molecular formula C11H9NO4 and a molecular weight of 219.20 g/mol. Its IUPAC name is 5-(2-nitrophenyl)-2,3-dihydropyran-6-one.
| Compound Name | 5-(2-nitrophenyl)-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 121219341 |
| Molecular Formula | C11H9NO4 |
| Molecular Weight | 219.20 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | 5-(2-nitrophenyl)-2,3-dihydropyran-6-one |
| SMILES | O=C1OCCC=C1c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H9NO4/c13-11-9(5-3-7-16-11)8-4-1-2-6-10(8)12(14)15/h1-2,4-6H,3,7H2 |
| InChIKey | BCOPYFQRIAJPDR-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.20 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|