C12H9N3O5S — CID 975525
(3S)-3-[[5-(2-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]oxolan-2-one (PubChem CID 975525) has the molecular formula C12H9N3O5S and a molecular weight of 307.29 g/mol. Its IUPAC name is (3S)-3-[[5-(2-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]oxolan-2-one.
| Compound Name | (3S)-3-[[5-(2-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]oxolan-2-one |
|---|---|
| PubChem CID | 975525 |
| Molecular Formula | C12H9N3O5S |
| Molecular Weight | 307.29 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | (3S)-3-[[5-(2-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]oxolan-2-one |
| SMILES | O=C1OCC[C@@H]1Sc1nnc(-c2ccccc2[N+](=O)[O-])o1 |
| InChI | InChI=1S/C12H9N3O5S/c16-11-9(5-6-19-11)21-12-14-13-10(20-12)7-3-1-2-4-8(7)15(17)18/h1-4,9H,5-6H2/t9-/m0/s1 |
| InChIKey | XBZMRYMSFGFRPT-VIFPVBQESA-N |
| XLogP | 2.05 |
| TPSA | 108.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.29 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|