C11H9NO3S — CID 2948558
3-(1,3-benzoxazol-2-ylsulfanyl)oxolan-2-one (PubChem CID 2948558) has the molecular formula C11H9NO3S and a molecular weight of 235.26 g/mol. Its IUPAC name is 3-(1,3-benzoxazol-2-ylsulfanyl)oxolan-2-one.
| Compound Name | 3-(1,3-benzoxazol-2-ylsulfanyl)oxolan-2-one |
|---|---|
| PubChem CID | 2948558 |
| Molecular Formula | C11H9NO3S |
| Molecular Weight | 235.26 g/mol |
| Exact Mass | 235.03 |
| IUPAC Name | 3-(1,3-benzoxazol-2-ylsulfanyl)oxolan-2-one |
| SMILES | O=C1OCCC1Sc1nc2ccccc2o1 |
| InChI | InChI=1S/C11H9NO3S/c13-10-9(5-6-14-10)16-11-12-7-3-1-2-4-8(7)15-11/h1-4,9H,5-6H2 |
| InChIKey | CWEZJROKUANAEZ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.26 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |