C19H15NO3S — CID 1289611
(3R)-3-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]oxolan-2-one (PubChem CID 1289611) has the molecular formula C19H15NO3S and a molecular weight of 337.40 g/mol. Its IUPAC name is (3R)-3-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]oxolan-2-one.
| Compound Name | (3R)-3-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]oxolan-2-one |
|---|---|
| PubChem CID | 1289611 |
| Molecular Formula | C19H15NO3S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | (3R)-3-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]oxolan-2-one |
| SMILES | O=C1OCC[C@H]1Sc1nc(-c2ccccc2)c(-c2ccccc2)o1 |
| InChI | InChI=1S/C19H15NO3S/c21-18-15(11-12-22-18)24-19-20-16(13-7-3-1-4-8-13)17(23-19)14-9-5-2-6-10-14/h1-10,15H,11-12H2/t15-/m1/s1 |
| InChIKey | RTWXQWVWRRRBND-OAHLLOKOSA-N |
| XLogP | 4.42 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |