C13H11NO2S2 — CID 2304233
(3S)-3-[(4-phenyl-1,3-thiazol-2-yl)sulfanyl]oxolan-2-one (PubChem CID 2304233) has the molecular formula C13H11NO2S2 and a molecular weight of 277.37 g/mol. Its IUPAC name is (3S)-3-[(4-phenyl-1,3-thiazol-2-yl)sulfanyl]oxolan-2-one.
| Compound Name | (3S)-3-[(4-phenyl-1,3-thiazol-2-yl)sulfanyl]oxolan-2-one |
|---|---|
| PubChem CID | 2304233 |
| Molecular Formula | C13H11NO2S2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.02 |
| IUPAC Name | (3S)-3-[(4-phenyl-1,3-thiazol-2-yl)sulfanyl]oxolan-2-one |
| SMILES | O=C1OCC[C@@H]1Sc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C13H11NO2S2/c15-12-11(6-7-16-12)18-13-14-10(8-17-13)9-4-2-1-3-5-9/h1-5,8,11H,6-7H2/t11-/m0/s1 |
| InChIKey | ICCUGQLIUUPDSK-NSHDSACASA-N |
| XLogP | 3.22 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |