C16H12N2O2S2 — CID 41013550
(3R)-3-(5-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanyloxolan-2-one (PubChem CID 41013550) has the molecular formula C16H12N2O2S2 and a molecular weight of 328.42 g/mol. Its IUPAC name is (3R)-3-(5-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanyloxolan-2-one.
| Compound Name | (3R)-3-(5-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanyloxolan-2-one |
|---|---|
| PubChem CID | 41013550 |
| Molecular Formula | C16H12N2O2S2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | (3R)-3-(5-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanyloxolan-2-one |
| SMILES | O=C1OCC[C@H]1Sc1ncnc2scc(-c3ccccc3)c12 |
| InChI | InChI=1S/C16H12N2O2S2/c19-16-12(6-7-20-16)22-15-13-11(10-4-2-1-3-5-10)8-21-14(13)17-9-18-15/h1-5,8-9,12H,6-7H2/t12-/m1/s1 |
| InChIKey | WXRCSFKXVMUNCF-GFCCVEGCSA-N |
| XLogP | 3.77 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |