C11H11NO3S2 — CID 40557013
(3S)-3-(1,3-benzoxazol-2-ylsulfanyl)thiolane 1,1-dioxide (PubChem CID 40557013) has the molecular formula C11H11NO3S2 and a molecular weight of 269.35 g/mol. Its IUPAC name is (3S)-3-(1,3-benzoxazol-2-ylsulfanyl)thiolane 1,1-dioxide.
| Compound Name | (3S)-3-(1,3-benzoxazol-2-ylsulfanyl)thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 40557013 |
| Molecular Formula | C11H11NO3S2 |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.02 |
| IUPAC Name | (3S)-3-(1,3-benzoxazol-2-ylsulfanyl)thiolane 1,1-dioxide |
| SMILES | O=S1(=O)CC[C@H](Sc2nc3ccccc3o2)C1 |
| InChI | InChI=1S/C11H11NO3S2/c13-17(14)6-5-8(7-17)16-11-12-9-3-1-2-4-10(9)15-11/h1-4,8H,5-7H2/t8-/m0/s1 |
| InChIKey | IFXGOKCOTOTUHI-QMMMGPOBSA-N |
| XLogP | 2.11 |
| TPSA | 60.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |