C15H20N2OS — CID 64648781
2-(1,3-benzoxazol-2-ylsulfanyl)-4,4-dimethylcyclohexan-1-amine (PubChem CID 64648781) has the molecular formula C15H20N2OS and a molecular weight of 276.40 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-2-ylsulfanyl)-4,4-dimethylcyclohexan-1-amine.
| Compound Name | 2-(1,3-benzoxazol-2-ylsulfanyl)-4,4-dimethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 64648781 |
| Molecular Formula | C15H20N2OS |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 2-(1,3-benzoxazol-2-ylsulfanyl)-4,4-dimethylcyclohexan-1-amine |
| SMILES | CC1(C)CCC(N)C(Sc2nc3ccccc3o2)C1 |
| InChI | InChI=1S/C15H20N2OS/c1-15(2)8-7-10(16)13(9-15)19-14-17-11-5-3-4-6-12(11)18-14/h3-6,10,13H,7-9,16H2,1-2H3 |
| InChIKey | OKPPXEWHFJBVEQ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |