C17H17NO3S — CID 18834305
S-(1,3-benzoxazol-2-yl) 7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carbothioate (PubChem CID 18834305) has the molecular formula C17H17NO3S and a molecular weight of 315.39 g/mol. Its IUPAC name is S-(1,3-benzoxazol-2-yl) 7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carbothioate.
| Compound Name | S-(1,3-benzoxazol-2-yl) 7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carbothioate |
|---|---|
| PubChem CID | 18834305 |
| Molecular Formula | C17H17NO3S |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | S-(1,3-benzoxazol-2-yl) 7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carbothioate |
| SMILES | CC1(C)C2CCC1(C(=O)Sc1nc3ccccc3o1)C(=O)C2 |
| InChI | InChI=1S/C17H17NO3S/c1-16(2)10-7-8-17(16,13(19)9-10)14(20)22-15-18-11-5-3-4-6-12(11)21-15/h3-6,10H,7-9H2,1-2H3 |
| InChIKey | YXEYYHPOIRKCOY-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 60.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|