C19H23N3O2S — CID 20970243
2-(1,3-benzoxazol-2-ylsulfanyl)-N-[(E)-[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]acetamide (PubChem CID 20970243) has the molecular formula C19H23N3O2S and a molecular weight of 357.48 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-2-ylsulfanyl)-N-[(E)-[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]acetamide.
| Compound Name | 2-(1,3-benzoxazol-2-ylsulfanyl)-N-[(E)-[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]acetamide |
|---|---|
| PubChem CID | 20970243 |
| Molecular Formula | C19H23N3O2S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 2-(1,3-benzoxazol-2-ylsulfanyl)-N-[(E)-[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]acetamide |
| SMILES | CC1(C)[C@@H]2CC[C@]1(C)/C(=N/NC(=O)CSc1nc3ccccc3o1)C2 |
| InChI | InChI=1S/C19H23N3O2S/c1-18(2)12-8-9-19(18,3)15(10-12)21-22-16(23)11-25-17-20-13-6-4-5-7-14(13)24-17/h4-7,12H,8-11H2,1-3H3,(H,22,23)/b21-15+/t12-,19-/m1/s1 |
| InChIKey | ZQLOYEKEXMAITR-VILWHLOOSA-N |
| XLogP | 4.24 |
| TPSA | 67.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|