C22H29N5O2S — CID 76855900
2-[[5-cyclopropyl-4-(furan-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino]acetamide (PubChem CID 76855900) has the molecular formula C22H29N5O2S and a molecular weight of 427.57 g/mol. Its IUPAC name is 2-[[5-cyclopropyl-4-(furan-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino]acetamide.
| Compound Name | 2-[[5-cyclopropyl-4-(furan-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino]acetamide |
|---|---|
| PubChem CID | 76855900 |
| Molecular Formula | C22H29N5O2S |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | 2-[[5-cyclopropyl-4-(furan-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino]acetamide |
| SMILES | CC12CCC(CC1=NNC(=O)CSc1nnc(C3CC3)n1Cc1ccco1)C2(C)C |
| InChI | InChI=1S/C22H29N5O2S/c1-21(2)15-8-9-22(21,3)17(11-15)23-24-18(28)13-30-20-26-25-19(14-6-7-14)27(20)12-16-5-4-10-29-16/h4-5,10,14-15H,6-9,11-13H2,1-3H3,(H,24,28) |
| InChIKey | GKTUJXXFXITWRD-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 85.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|