C20H23N3O — CID 23327836
N-[(E)-[(1R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]quinoline-2-carboxamide (PubChem CID 23327836) has the molecular formula C20H23N3O and a molecular weight of 321.42 g/mol. Its IUPAC name is N-[(E)-[(1R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]quinoline-2-carboxamide.
| Compound Name | N-[(E)-[(1R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 23327836 |
| Molecular Formula | C20H23N3O |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | N-[(E)-[(1R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]quinoline-2-carboxamide |
| SMILES | CC1(C)[C@H]2CC[C@@]1(C)/C(=N/NC(=O)c1ccc3ccccc3n1)C2 |
| InChI | InChI=1S/C20H23N3O/c1-19(2)14-10-11-20(19,3)17(12-14)22-23-18(24)16-9-8-13-6-4-5-7-15(13)21-16/h4-9,14H,10-12H2,1-3H3,(H,23,24)/b22-17+/t14-,20-/m0/s1 |
| InChIKey | RVHDERNNETZFHU-SHGSZIJCSA-N |
| XLogP | 4.17 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|