C18H24N4O2 — CID 23328034
3-(carbamoylamino)-N-[(E)-[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]benzamide (PubChem CID 23328034) has the molecular formula C18H24N4O2 and a molecular weight of 328.42 g/mol. Its IUPAC name is 3-(carbamoylamino)-N-[(E)-[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]benzamide.
| Compound Name | 3-(carbamoylamino)-N-[(E)-[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]benzamide |
|---|---|
| PubChem CID | 23328034 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | 3-(carbamoylamino)-N-[(E)-[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]benzamide |
| SMILES | CC1(C)[C@@H]2CC[C@]1(C)/C(=N/NC(=O)c1cccc(NC(N)=O)c1)C2 |
| InChI | InChI=1S/C18H24N4O2/c1-17(2)12-7-8-18(17,3)14(10-12)21-22-15(23)11-5-4-6-13(9-11)20-16(19)24/h4-6,9,12H,7-8,10H2,1-3H3,(H,22,23)(H3,19,20,24)/b21-14+/t12-,18-/m1/s1 |
| InChIKey | CKRAHWSAYBKQCR-DMSFWVQNSA-N |
| XLogP | 3.11 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|