C19H28N4O2S2 — CID 8660073
1-[3-(dimethylsulfamoyl)phenyl]-3-[(Z)-[(1S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]thiourea (PubChem CID 8660073) has the molecular formula C19H28N4O2S2 and a molecular weight of 408.59 g/mol. Its IUPAC name is 1-[3-(dimethylsulfamoyl)phenyl]-3-[(Z)-[(1S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]thiourea.
| Compound Name | 1-[3-(dimethylsulfamoyl)phenyl]-3-[(Z)-[(1S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]thiourea |
|---|---|
| PubChem CID | 8660073 |
| Molecular Formula | C19H28N4O2S2 |
| Molecular Weight | 408.59 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 1-[3-(dimethylsulfamoyl)phenyl]-3-[(Z)-[(1S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]thiourea |
| SMILES | CN(C)S(=O)(=O)c1cccc(NC(=S)N/N=C2/C[C@@H]3CC[C@@]2(C)C3(C)C)c1 |
| InChI | InChI=1S/C19H28N4O2S2/c1-18(2)13-9-10-19(18,3)16(11-13)21-22-17(26)20-14-7-6-8-15(12-14)27(24,25)23(4)5/h6-8,12-13H,9-11H2,1-5H3,(H2,20,22,26)/b21-16-/t13-,19+/m0/s1 |
| InChIKey | HKLWTJIQOIBDOY-JSHBZVNWSA-N |
| XLogP | 3.43 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.59 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|