C17H21BrN2O — CID 23314749
3-bromo-N-[(E)-[(1R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]benzamide (PubChem CID 23314749) has the molecular formula C17H21BrN2O and a molecular weight of 349.27 g/mol. Its IUPAC name is 3-bromo-N-[(E)-[(1R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]benzamide.
| Compound Name | 3-bromo-N-[(E)-[(1R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]benzamide |
|---|---|
| PubChem CID | 23314749 |
| Molecular Formula | C17H21BrN2O |
| Molecular Weight | 349.27 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 3-bromo-N-[(E)-[(1R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]benzamide |
| SMILES | CC1(C)[C@H]2CC[C@@]1(C)/C(=N/NC(=O)c1cccc(Br)c1)C2 |
| InChI | InChI=1S/C17H21BrN2O/c1-16(2)12-7-8-17(16,3)14(10-12)19-20-15(21)11-5-4-6-13(18)9-11/h4-6,9,12H,7-8,10H2,1-3H3,(H,20,21)/b19-14+/t12-,17-/m0/s1 |
| InChIKey | GGANCFYHQIQCSZ-MHAIZMEMSA-N |
| XLogP | 4.38 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.27 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|