C18H24ClN3O3S — CID 23327988
4-chloro-3-(methylsulfamoyl)-N-[(Z)-[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]benzamide (PubChem CID 23327988) has the molecular formula C18H24ClN3O3S and a molecular weight of 397.93 g/mol. Its IUPAC name is 4-chloro-3-(methylsulfamoyl)-N-[(Z)-[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]benzamide.
| Compound Name | 4-chloro-3-(methylsulfamoyl)-N-[(Z)-[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]benzamide |
|---|---|
| PubChem CID | 23327988 |
| Molecular Formula | C18H24ClN3O3S |
| Molecular Weight | 397.93 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | 4-chloro-3-(methylsulfamoyl)-N-[(Z)-[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]benzamide |
| SMILES | CNS(=O)(=O)c1cc(C(=O)N/N=C2/C[C@H]3CC[C@@]2(C)C3(C)C)ccc1Cl |
| InChI | InChI=1S/C18H24ClN3O3S/c1-17(2)12-7-8-18(17,3)15(10-12)21-22-16(23)11-5-6-13(19)14(9-11)26(24,25)20-4/h5-6,9,12,20H,7-8,10H2,1-4H3,(H,22,23)/b21-15-/t12-,18-/m1/s1 |
| InChIKey | FWSQSDKVDKVSAV-FUFPAEBYSA-N |
| XLogP | 3.18 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.93 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|