C19H24N2O3 — CID 9371298
methyl 4-[[(Z)-[(1S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]carbamoyl]benzoate (PubChem CID 9371298) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is methyl 4-[[(Z)-[(1S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]carbamoyl]benzoate.
| Compound Name | methyl 4-[[(Z)-[(1S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]carbamoyl]benzoate |
|---|---|
| PubChem CID | 9371298 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | methyl 4-[[(Z)-[(1S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]carbamoyl]benzoate |
| SMILES | COC(=O)c1ccc(C(=O)N/N=C2/C[C@@H]3CC[C@@]2(C)C3(C)C)cc1 |
| InChI | InChI=1S/C19H24N2O3/c1-18(2)14-9-10-19(18,3)15(11-14)20-21-16(22)12-5-7-13(8-6-12)17(23)24-4/h5-8,14H,9-11H2,1-4H3,(H,21,22)/b20-15-/t14-,19+/m0/s1 |
| InChIKey | SJSIUAFQDSUDBL-RJAYILIXSA-N |
| XLogP | 3.41 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|