C21H29N3O3 — CID 23327938
4-ethoxy-N-[2-oxo-2-[(2Z)-2-[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]hydrazinyl]ethyl]benzamide (PubChem CID 23327938) has the molecular formula C21H29N3O3 and a molecular weight of 371.48 g/mol. Its IUPAC name is 4-ethoxy-N-[2-oxo-2-[(2Z)-2-[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]hydrazinyl]ethyl]benzamide.
| Compound Name | 4-ethoxy-N-[2-oxo-2-[(2Z)-2-[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]hydrazinyl]ethyl]benzamide |
|---|---|
| PubChem CID | 23327938 |
| Molecular Formula | C21H29N3O3 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | 4-ethoxy-N-[2-oxo-2-[(2Z)-2-[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]hydrazinyl]ethyl]benzamide |
| SMILES | CCOc1ccc(C(=O)NCC(=O)N/N=C2/C[C@H]3CC[C@@]2(C)C3(C)C)cc1 |
| InChI | InChI=1S/C21H29N3O3/c1-5-27-16-8-6-14(7-9-16)19(26)22-13-18(25)24-23-17-12-15-10-11-21(17,4)20(15,2)3/h6-9,15H,5,10-13H2,1-4H3,(H,22,26)(H,24,25)/b23-17-/t15-,21-/m1/s1 |
| InChIKey | METICYYNUDPNHG-QJWKYJBVSA-N |
| XLogP | 3.13 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|