About N-(4-ethoxyphenyl)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-imine
N-(4-ethoxyphenyl)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-imine (PubChem CID 170838336) has the molecular formula C18H25NO
and a molecular weight of 271.40 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-imine.
Molecular Properties
| Compound Name | N-(4-ethoxyphenyl)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-imine |
| PubChem CID | 170838336 |
| Molecular Formula | C18H25NO |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | N-(4-ethoxyphenyl)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-imine |
| SMILES | CCOc1ccc(/N=C2\CC3CCC2(C)C3(C)C)cc1 |
| InChI | InChI=1S/C18H25NO/c1-5-20-15-8-6-14(7-9-15)19-16-12-13-10-11-18(16,4)17(13,2)3/h6-9,13H,5,10-12H2,1-4H3/b19-16+ |
| InChIKey | ABNDSXKZUUVDPN-KNTRCKAVSA-N |
| XLogP | 5.00 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-(4-ethoxyphenyl)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-ethoxyphenyl)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-imine?
The IUPAC name of N-(4-ethoxyphenyl)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-imine (CID 170838336) is N-(4-ethoxyphenyl)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-imine.
What is the SMILES notation for N-(4-ethoxyphenyl)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-imine?
The canonical SMILES for N-(4-ethoxyphenyl)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-imine is CCOc1ccc(/N=C2\CC3CCC2(C)C3(C)C)cc1.
What is the InChIKey of N-(4-ethoxyphenyl)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-imine?
The InChIKey is ABNDSXKZUUVDPN-KNTRCKAVSA-N. The full InChI is InChI=1S/C18H25NO/c1-5-20-15-8-6-14(7-9-15)19-16-12-13-10-11-18(16,4)17(13,2)3/h6-9,13H,5,10-12H2,1-4H3/b19-16+.
What are the key properties of N-(4-ethoxyphenyl)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-imine?
N-(4-ethoxyphenyl)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-imine has a molecular weight of 271.40 g/mol, XLogP of 5.00, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-ethoxyphenyl)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-imine is sourced from PubChem (CID 170838336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).