C19H26N2O2 — CID 135558367
4-methoxy-2-[(E)-C-methyl-N-[(E)-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino]carbonimidoyl]phenol (PubChem CID 135558367) has the molecular formula C19H26N2O2 and a molecular weight of 314.43 g/mol. Its IUPAC name is 4-methoxy-2-[(E)-C-methyl-N-[(E)-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino]carbonimidoyl]phenol.
| Compound Name | 4-methoxy-2-[(E)-C-methyl-N-[(E)-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino]carbonimidoyl]phenol |
|---|---|
| PubChem CID | 135558367 |
| Molecular Formula | C19H26N2O2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | 4-methoxy-2-[(E)-C-methyl-N-[(E)-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino]carbonimidoyl]phenol |
| SMILES | COc1ccc(O)c(/C(C)=N/N=C2\CC3CCC2(C)C3(C)C)c1 |
| InChI | InChI=1S/C19H26N2O2/c1-12(15-11-14(23-5)6-7-16(15)22)20-21-17-10-13-8-9-19(17,4)18(13,2)3/h6-7,11,13,22H,8-10H2,1-5H3/b20-12+,21-17+ |
| InChIKey | GJJRMWWSUYNJKY-PPTAUHKUSA-N |
| XLogP | 4.41 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|