C19H24BrN3O2 — CID 9371020
4-bromo-N-[2-oxo-2-[(2E)-2-[(1R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]hydrazinyl]ethyl]benzamide (PubChem CID 9371020) has the molecular formula C19H24BrN3O2 and a molecular weight of 406.32 g/mol. Its IUPAC name is 4-bromo-N-[2-oxo-2-[(2E)-2-[(1R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]hydrazinyl]ethyl]benzamide.
| Compound Name | 4-bromo-N-[2-oxo-2-[(2E)-2-[(1R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]hydrazinyl]ethyl]benzamide |
|---|---|
| PubChem CID | 9371020 |
| Molecular Formula | C19H24BrN3O2 |
| Molecular Weight | 406.32 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | 4-bromo-N-[2-oxo-2-[(2E)-2-[(1R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]hydrazinyl]ethyl]benzamide |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)/C(=N/NC(=O)CNC(=O)c1ccc(Br)cc1)C2 |
| InChI | InChI=1S/C19H24BrN3O2/c1-18(2)13-8-9-19(18,3)15(10-13)22-23-16(24)11-21-17(25)12-4-6-14(20)7-5-12/h4-7,13H,8-11H2,1-3H3,(H,21,25)(H,23,24)/b22-15+/t13-,19+/m1/s1 |
| InChIKey | RNARNHJPMSVTJD-QMWASXFSSA-N |
| XLogP | 3.50 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.32 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|