C18H31N3O3 — CID 9372150
tert-butyl N-[3-oxo-3-[(2Z)-2-[(1S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]hydrazinyl]propyl]carbamate (PubChem CID 9372150) has the molecular formula C18H31N3O3 and a molecular weight of 337.46 g/mol. Its IUPAC name is tert-butyl N-[3-oxo-3-[(2Z)-2-[(1S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]hydrazinyl]propyl]carbamate.
| Compound Name | tert-butyl N-[3-oxo-3-[(2Z)-2-[(1S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]hydrazinyl]propyl]carbamate |
|---|---|
| PubChem CID | 9372150 |
| Molecular Formula | C18H31N3O3 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.24 |
| IUPAC Name | tert-butyl N-[3-oxo-3-[(2Z)-2-[(1S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]hydrazinyl]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(=O)N/N=C1/C[C@@H]2CC[C@@]1(C)C2(C)C |
| InChI | InChI=1S/C18H31N3O3/c1-16(2,3)24-15(23)19-10-8-14(22)21-20-13-11-12-7-9-18(13,6)17(12,4)5/h12H,7-11H2,1-6H3,(H,19,23)(H,21,22)/b20-13-/t12-,18+/m0/s1 |
| InChIKey | OUVCYGXOHWKKNA-VVMZBNJISA-N |
| XLogP | 3.22 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|