C20H28N2O3S — CID 9371083
3-(4-methylphenyl)sulfonyl-N-[(Z)-[(1R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]propanamide (PubChem CID 9371083) has the molecular formula C20H28N2O3S and a molecular weight of 376.52 g/mol. Its IUPAC name is 3-(4-methylphenyl)sulfonyl-N-[(Z)-[(1R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]propanamide.
| Compound Name | 3-(4-methylphenyl)sulfonyl-N-[(Z)-[(1R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]propanamide |
|---|---|
| PubChem CID | 9371083 |
| Molecular Formula | C20H28N2O3S |
| Molecular Weight | 376.52 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 3-(4-methylphenyl)sulfonyl-N-[(Z)-[(1R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]propanamide |
| SMILES | Cc1ccc(S(=O)(=O)CCC(=O)N/N=C2/C[C@H]3CC[C@]2(C)C3(C)C)cc1 |
| InChI | InChI=1S/C20H28N2O3S/c1-14-5-7-16(8-6-14)26(24,25)12-10-18(23)22-21-17-13-15-9-11-20(17,4)19(15,2)3/h5-8,15H,9-13H2,1-4H3,(H,22,23)/b21-17-/t15-,20+/m1/s1 |
| InChIKey | LYNCKFPUDZRDSE-YQAXFJDBSA-N |
| XLogP | 3.48 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.52 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|