C22H27N3O3 — CID 23327909
4-(1,3-dioxoisoindol-2-yl)-N-[(E)-[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]butanamide (PubChem CID 23327909) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is 4-(1,3-dioxoisoindol-2-yl)-N-[(E)-[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]butanamide.
| Compound Name | 4-(1,3-dioxoisoindol-2-yl)-N-[(E)-[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]butanamide |
|---|---|
| PubChem CID | 23327909 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | 4-(1,3-dioxoisoindol-2-yl)-N-[(E)-[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]butanamide |
| SMILES | CC1(C)[C@@H]2CC[C@]1(C)/C(=N/NC(=O)CCCN1C(=O)c3ccccc3C1=O)C2 |
| InChI | InChI=1S/C22H27N3O3/c1-21(2)14-10-11-22(21,3)17(13-14)23-24-18(26)9-6-12-25-19(27)15-7-4-5-8-16(15)20(25)28/h4-5,7-8,14H,6,9-13H2,1-3H3,(H,24,26)/b23-17+/t14-,22-/m1/s1 |
| InChIKey | OFAGLLNBYGPJKZ-MVIXNICGSA-N |
| XLogP | 3.38 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|