C21H27N3O3 — CID 23327980
4-(2-oxo-1,3-benzoxazol-3-yl)-N-[(E)-[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]butanamide (PubChem CID 23327980) has the molecular formula C21H27N3O3 and a molecular weight of 369.47 g/mol. Its IUPAC name is 4-(2-oxo-1,3-benzoxazol-3-yl)-N-[(E)-[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]butanamide.
| Compound Name | 4-(2-oxo-1,3-benzoxazol-3-yl)-N-[(E)-[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]butanamide |
|---|---|
| PubChem CID | 23327980 |
| Molecular Formula | C21H27N3O3 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | 4-(2-oxo-1,3-benzoxazol-3-yl)-N-[(E)-[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]butanamide |
| SMILES | CC1(C)[C@@H]2CC[C@]1(C)/C(=N/NC(=O)CCCn1c(=O)oc3ccccc31)C2 |
| InChI | InChI=1S/C21H27N3O3/c1-20(2)14-10-11-21(20,3)17(13-14)22-23-18(25)9-6-12-24-15-7-4-5-8-16(15)27-19(24)26/h4-5,7-8,14H,6,9-13H2,1-3H3,(H,23,25)/b22-17+/t14-,21-/m1/s1 |
| InChIKey | UTNDXBAKUHTNAG-WZLBSSIKSA-N |
| XLogP | 3.69 |
| TPSA | 76.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|