C17H29N3O — CID 6160811
1-cyclohexyl-3-[(Z)-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino]urea (PubChem CID 6160811) has the molecular formula C17H29N3O and a molecular weight of 291.44 g/mol. Its IUPAC name is 1-cyclohexyl-3-[(Z)-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino]urea.
| Compound Name | 1-cyclohexyl-3-[(Z)-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino]urea |
|---|---|
| PubChem CID | 6160811 |
| Molecular Formula | C17H29N3O |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.23 |
| IUPAC Name | 1-cyclohexyl-3-[(Z)-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino]urea |
| SMILES | CC12CCC(C/C1=N/NC(=O)NC1CCCCC1)C2(C)C |
| InChI | InChI=1S/C17H29N3O/c1-16(2)12-9-10-17(16,3)14(11-12)19-20-15(21)18-13-7-5-4-6-8-13/h12-13H,4-11H2,1-3H3,(H2,18,20,21)/b19-14- |
| InChIKey | WTOPAVXMZDSENX-RGEXLXHISA-N |
| XLogP | 3.82 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|