C19H24N2O2S — CID 51707862
2-(1,3-benzoxazol-2-ylsulfanyl)-N-[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]acetamide (PubChem CID 51707862) has the molecular formula C19H24N2O2S and a molecular weight of 344.48 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-2-ylsulfanyl)-N-[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]acetamide.
| Compound Name | 2-(1,3-benzoxazol-2-ylsulfanyl)-N-[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]acetamide |
|---|---|
| PubChem CID | 51707862 |
| Molecular Formula | C19H24N2O2S |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 2-(1,3-benzoxazol-2-ylsulfanyl)-N-[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]acetamide |
| SMILES | CC1(C)[C@H]2CC[C@]1(C)[C@H](NC(=O)CSc1nc3ccccc3o1)C2 |
| InChI | InChI=1S/C19H24N2O2S/c1-18(2)12-8-9-19(18,3)15(10-12)21-16(22)11-24-17-20-13-6-4-5-7-14(13)23-17/h4-7,12,15H,8-11H2,1-3H3,(H,21,22)/t12-,15+,19+/m0/s1 |
| InChIKey | ZOJYAXVXZMFELB-IOHHAYIISA-N |
| XLogP | 4.25 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |