C10H13NO3 — CID 102244184
(1S,4R)-7,7-dimethyl-N,2-dioxobicyclo[2.2.1]heptane-1-carboxamide (PubChem CID 102244184) has the molecular formula C10H13NO3 and a molecular weight of 195.22 g/mol. Its IUPAC name is (1S,4R)-7,7-dimethyl-N,2-dioxobicyclo[2.2.1]heptane-1-carboxamide.
| Compound Name | (1S,4R)-7,7-dimethyl-N,2-dioxobicyclo[2.2.1]heptane-1-carboxamide |
|---|---|
| PubChem CID | 102244184 |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | (1S,4R)-7,7-dimethyl-N,2-dioxobicyclo[2.2.1]heptane-1-carboxamide |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C(=O)N=O)C(=O)C2 |
| InChI | InChI=1S/C10H13NO3/c1-9(2)6-3-4-10(9,7(12)5-6)8(13)11-14/h6H,3-5H2,1-2H3/t6-,10+/m1/s1 |
| InChIKey | GEHBFHBQWOVMJZ-LDWIPMOCSA-N |
| XLogP | 1.67 |
| TPSA | 63.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|