C11H17NO2 — CID 102547267
N,7,7-trimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxamide (PubChem CID 102547267) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is N,7,7-trimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxamide.
| Compound Name | N,7,7-trimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxamide |
|---|---|
| PubChem CID | 102547267 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | N,7,7-trimethyl-2-oxobicyclo[2.2.1]heptane-1-carboxamide |
| SMILES | CNC(=O)C12CCC(CC1=O)C2(C)C |
| InChI | InChI=1S/C11H17NO2/c1-10(2)7-4-5-11(10,8(13)6-7)9(14)12-3/h7H,4-6H2,1-3H3,(H,12,14) |
| InChIKey | LIANGGWGDOAZNJ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|