C17H18Cl2N2O3 — CID 18834286
N'-(2,4-dichlorobenzoyl)-7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carbohydrazide (PubChem CID 18834286) has the molecular formula C17H18Cl2N2O3 and a molecular weight of 369.25 g/mol. Its IUPAC name is N'-(2,4-dichlorobenzoyl)-7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carbohydrazide.
| Compound Name | N'-(2,4-dichlorobenzoyl)-7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carbohydrazide |
|---|---|
| PubChem CID | 18834286 |
| Molecular Formula | C17H18Cl2N2O3 |
| Molecular Weight | 369.25 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | N'-(2,4-dichlorobenzoyl)-7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carbohydrazide |
| SMILES | CC1(C)C2CCC1(C(=O)NNC(=O)c1ccc(Cl)cc1Cl)C(=O)C2 |
| InChI | InChI=1S/C17H18Cl2N2O3/c1-16(2)9-5-6-17(16,13(22)7-9)15(24)21-20-14(23)11-4-3-10(18)8-12(11)19/h3-4,8-9H,5-7H2,1-2H3,(H,20,23)(H,21,24) |
| InChIKey | YWIMOYUJBVJRNR-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.25 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|