C22H18Cl2N6O3 — CID 18834932
4,5-dicyano-N'-[2-(2,4-dichlorophenoxy)acetyl]-11,11-dimethyl-3,6-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-1-carbohydrazide (PubChem CID 18834932) has the molecular formula C22H18Cl2N6O3 and a molecular weight of 485.33 g/mol. Its IUPAC name is 4,5-dicyano-N'-[2-(2,4-dichlorophenoxy)acetyl]-11,11-dimethyl-3,6-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-1-carbohydrazide.
| Compound Name | 4,5-dicyano-N'-[2-(2,4-dichlorophenoxy)acetyl]-11,11-dimethyl-3,6-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-1-carbohydrazide |
|---|---|
| PubChem CID | 18834932 |
| Molecular Formula | C22H18Cl2N6O3 |
| Molecular Weight | 485.33 g/mol |
| Exact Mass | 484.08 |
| IUPAC Name | 4,5-dicyano-N'-[2-(2,4-dichlorophenoxy)acetyl]-11,11-dimethyl-3,6-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-1-carbohydrazide |
| SMILES | CC1(C)C2CCC1(C(=O)NNC(=O)COc1ccc(Cl)cc1Cl)c1nc(C#N)c(C#N)nc12 |
| InChI | InChI=1S/C22H18Cl2N6O3/c1-21(2)12-5-6-22(21,19-18(12)27-14(8-25)15(9-26)28-19)20(32)30-29-17(31)10-33-16-4-3-11(23)7-13(16)24/h3-4,7,12H,5-6,10H2,1-2H3,(H,29,31)(H,30,32) |
| InChIKey | KZCQVWOSAVZVOF-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 140.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.33 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|