C14H11Cl3N4O3S — CID 18858831
4-chloro-N'-[2-(2,4-dichlorophenoxy)acetyl]-2-methylsulfanylpyrimidine-5-carbohydrazide (PubChem CID 18858831) has the molecular formula C14H11Cl3N4O3S and a molecular weight of 421.69 g/mol. Its IUPAC name is 4-chloro-N'-[2-(2,4-dichlorophenoxy)acetyl]-2-methylsulfanylpyrimidine-5-carbohydrazide.
| Compound Name | 4-chloro-N'-[2-(2,4-dichlorophenoxy)acetyl]-2-methylsulfanylpyrimidine-5-carbohydrazide |
|---|---|
| PubChem CID | 18858831 |
| Molecular Formula | C14H11Cl3N4O3S |
| Molecular Weight | 421.69 g/mol |
| Exact Mass | 419.96 |
| IUPAC Name | 4-chloro-N'-[2-(2,4-dichlorophenoxy)acetyl]-2-methylsulfanylpyrimidine-5-carbohydrazide |
| SMILES | CSc1ncc(C(=O)NNC(=O)COc2ccc(Cl)cc2Cl)c(Cl)n1 |
| InChI | InChI=1S/C14H11Cl3N4O3S/c1-25-14-18-5-8(12(17)19-14)13(23)21-20-11(22)6-24-10-3-2-7(15)4-9(10)16/h2-5H,6H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | KHUVTDRDITWACU-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.69 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|