C24H24N6O — CID 18834823
11,11-dimethyl-1-(4-phenylpiperazine-1-carbonyl)-3,6-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-4,5-dicarbonitrile (PubChem CID 18834823) has the molecular formula C24H24N6O and a molecular weight of 412.50 g/mol. Its IUPAC name is 11,11-dimethyl-1-(4-phenylpiperazine-1-carbonyl)-3,6-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-4,5-dicarbonitrile.
| Compound Name | 11,11-dimethyl-1-(4-phenylpiperazine-1-carbonyl)-3,6-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-4,5-dicarbonitrile |
|---|---|
| PubChem CID | 18834823 |
| Molecular Formula | C24H24N6O |
| Molecular Weight | 412.50 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | 11,11-dimethyl-1-(4-phenylpiperazine-1-carbonyl)-3,6-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-4,5-dicarbonitrile |
| SMILES | CC1(C)C2CCC1(C(=O)N1CCN(c3ccccc3)CC1)c1nc(C#N)c(C#N)nc12 |
| InChI | InChI=1S/C24H24N6O/c1-23(2)17-8-9-24(23,21-20(17)27-18(14-25)19(15-26)28-21)22(31)30-12-10-29(11-13-30)16-6-4-3-5-7-16/h3-7,17H,8-13H2,1-2H3 |
| InChIKey | BVWVHAKWAJMVLV-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 96.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.50 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |