C22H20N6O2 — CID 18834915
4,5-dicyano-11,11-dimethyl-N'-(4-methylbenzoyl)-3,6-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-1-carbohydrazide (PubChem CID 18834915) has the molecular formula C22H20N6O2 and a molecular weight of 400.44 g/mol. Its IUPAC name is 4,5-dicyano-11,11-dimethyl-N'-(4-methylbenzoyl)-3,6-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-1-carbohydrazide.
| Compound Name | 4,5-dicyano-11,11-dimethyl-N'-(4-methylbenzoyl)-3,6-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-1-carbohydrazide |
|---|---|
| PubChem CID | 18834915 |
| Molecular Formula | C22H20N6O2 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 4,5-dicyano-11,11-dimethyl-N'-(4-methylbenzoyl)-3,6-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-1-carbohydrazide |
| SMILES | Cc1ccc(C(=O)NNC(=O)C23CCC(c4nc(C#N)c(C#N)nc42)C3(C)C)cc1 |
| InChI | InChI=1S/C22H20N6O2/c1-12-4-6-13(7-5-12)19(29)27-28-20(30)22-9-8-14(21(22,2)3)17-18(22)26-16(11-24)15(10-23)25-17/h4-7,14H,8-9H2,1-3H3,(H,27,29)(H,28,30) |
| InChIKey | DIBIOWDNTPSZAL-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 131.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|