C22H21N5O — CID 18834840
4,5-dicyano-N-(4-ethylphenyl)-11,11-dimethyl-3,6-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-1-carboxamide (PubChem CID 18834840) has the molecular formula C22H21N5O and a molecular weight of 371.44 g/mol. Its IUPAC name is 4,5-dicyano-N-(4-ethylphenyl)-11,11-dimethyl-3,6-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-1-carboxamide.
| Compound Name | 4,5-dicyano-N-(4-ethylphenyl)-11,11-dimethyl-3,6-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-1-carboxamide |
|---|---|
| PubChem CID | 18834840 |
| Molecular Formula | C22H21N5O |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 4,5-dicyano-N-(4-ethylphenyl)-11,11-dimethyl-3,6-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-1-carboxamide |
| SMILES | CCc1ccc(NC(=O)C23CCC(c4nc(C#N)c(C#N)nc42)C3(C)C)cc1 |
| InChI | InChI=1S/C22H21N5O/c1-4-13-5-7-14(8-6-13)25-20(28)22-10-9-15(21(22,2)3)18-19(22)27-17(12-24)16(11-23)26-18/h5-8,15H,4,9-10H2,1-3H3,(H,25,28) |
| InChIKey | ZLRLECLOJLKMOY-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 102.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |