C22H21N5O2 — CID 18827328
4,5-dicyano-N-(4-methoxyphenyl)-8,11,11-trimethyl-3,6-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-1-carboxamide (PubChem CID 18827328) has the molecular formula C22H21N5O2 and a molecular weight of 387.44 g/mol. Its IUPAC name is 4,5-dicyano-N-(4-methoxyphenyl)-8,11,11-trimethyl-3,6-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-1-carboxamide.
| Compound Name | 4,5-dicyano-N-(4-methoxyphenyl)-8,11,11-trimethyl-3,6-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-1-carboxamide |
|---|---|
| PubChem CID | 18827328 |
| Molecular Formula | C22H21N5O2 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 4,5-dicyano-N-(4-methoxyphenyl)-8,11,11-trimethyl-3,6-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-1-carboxamide |
| SMILES | COc1ccc(NC(=O)C23CCC(C)(c4nc(C#N)c(C#N)nc42)C3(C)C)cc1 |
| InChI | InChI=1S/C22H21N5O2/c1-20(2)21(3)9-10-22(20,18-17(21)26-15(11-23)16(12-24)27-18)19(28)25-13-5-7-14(29-4)8-6-13/h5-8H,9-10H2,1-4H3,(H,25,28) |
| InChIKey | VTAFGNKDGYPYBE-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 111.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |