C21H18FN5O — CID 7335442
(1R,8R)-4,5-dicyano-N-(2-fluorophenyl)-8,11,11-trimethyl-3,6-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-1-carboxamide (PubChem CID 7335442) has the molecular formula C21H18FN5O and a molecular weight of 375.41 g/mol. Its IUPAC name is (1R,8R)-4,5-dicyano-N-(2-fluorophenyl)-8,11,11-trimethyl-3,6-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-1-carboxamide.
| Compound Name | (1R,8R)-4,5-dicyano-N-(2-fluorophenyl)-8,11,11-trimethyl-3,6-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-1-carboxamide |
|---|---|
| PubChem CID | 7335442 |
| Molecular Formula | C21H18FN5O |
| Molecular Weight | 375.41 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | (1R,8R)-4,5-dicyano-N-(2-fluorophenyl)-8,11,11-trimethyl-3,6-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-1-carboxamide |
| SMILES | CC1(C)[C@@]2(C)CC[C@]1(C(=O)Nc1ccccc1F)c1nc(C#N)c(C#N)nc12 |
| InChI | InChI=1S/C21H18FN5O/c1-19(2)20(3)8-9-21(19,18(28)27-13-7-5-4-6-12(13)22)17-16(20)25-14(10-23)15(11-24)26-17/h4-7H,8-9H2,1-3H3,(H,27,28)/t20-,21+/m0/s1 |
| InChIKey | SNRYUDSNEJQOQQ-LEWJYISDSA-N |
| XLogP | 3.33 |
| TPSA | 102.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.41 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |