C21H17F2N5O — CID 98073040
(1S,8R)-4,5-dicyano-N-(3,4-difluorophenyl)-8,11,11-trimethyl-3,6-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-1-carboxamide (PubChem CID 98073040) has the molecular formula C21H17F2N5O and a molecular weight of 393.40 g/mol. Its IUPAC name is (1S,8R)-4,5-dicyano-N-(3,4-difluorophenyl)-8,11,11-trimethyl-3,6-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-1-carboxamide.
| Compound Name | (1S,8R)-4,5-dicyano-N-(3,4-difluorophenyl)-8,11,11-trimethyl-3,6-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-1-carboxamide |
|---|---|
| PubChem CID | 98073040 |
| Molecular Formula | C21H17F2N5O |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | (1S,8R)-4,5-dicyano-N-(3,4-difluorophenyl)-8,11,11-trimethyl-3,6-diazatricyclo[6.2.1.02,7]undeca-2,4,6-triene-1-carboxamide |
| SMILES | CC1(C)[C@@]2(C)CC[C@@]1(C(=O)Nc1ccc(F)c(F)c1)c1nc(C#N)c(C#N)nc12 |
| InChI | InChI=1S/C21H17F2N5O/c1-19(2)20(3)6-7-21(19,17-16(20)27-14(9-24)15(10-25)28-17)18(29)26-11-4-5-12(22)13(23)8-11/h4-5,8H,6-7H2,1-3H3,(H,26,29)/t20-,21-/m0/s1 |
| InChIKey | ALMKITXPGWQNIY-SFTDATJTSA-N |
| XLogP | 3.47 |
| TPSA | 102.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |