C25H27N3O2 — CID 18830198
N-[3-(1-hydroxyethyl)phenyl]-12,15,15-trimethyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaene-1-carboxamide (PubChem CID 18830198) has the molecular formula C25H27N3O2 and a molecular weight of 401.51 g/mol. Its IUPAC name is N-[3-(1-hydroxyethyl)phenyl]-12,15,15-trimethyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaene-1-carboxamide.
| Compound Name | N-[3-(1-hydroxyethyl)phenyl]-12,15,15-trimethyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaene-1-carboxamide |
|---|---|
| PubChem CID | 18830198 |
| Molecular Formula | C25H27N3O2 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | N-[3-(1-hydroxyethyl)phenyl]-12,15,15-trimethyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaene-1-carboxamide |
| SMILES | CC(O)c1cccc(NC(=O)C23CCC(C)(c4nc5ccccc5nc42)C3(C)C)c1 |
| InChI | InChI=1S/C25H27N3O2/c1-15(29)16-8-7-9-17(14-16)26-22(30)25-13-12-24(4,23(25,2)3)20-21(25)28-19-11-6-5-10-18(19)27-20/h5-11,14-15,29H,12-13H2,1-4H3,(H,26,30) |
| InChIKey | PQEWVBWEWBFXSV-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |