C23H21BrN4O3 — CID 4728737
N-(2-bromo-5-nitrophenyl)-12,15,15-trimethyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaene-1-carboxamide (PubChem CID 4728737) has the molecular formula C23H21BrN4O3 and a molecular weight of 481.35 g/mol. Its IUPAC name is N-(2-bromo-5-nitrophenyl)-12,15,15-trimethyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaene-1-carboxamide.
| Compound Name | N-(2-bromo-5-nitrophenyl)-12,15,15-trimethyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaene-1-carboxamide |
|---|---|
| PubChem CID | 4728737 |
| Molecular Formula | C23H21BrN4O3 |
| Molecular Weight | 481.35 g/mol |
| Exact Mass | 480.08 |
| IUPAC Name | N-(2-bromo-5-nitrophenyl)-12,15,15-trimethyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaene-1-carboxamide |
| SMILES | CC12CCC(C(=O)Nc3cc([N+](=O)[O-])ccc3Br)(c3nc4ccccc4nc31)C2(C)C |
| InChI | InChI=1S/C23H21BrN4O3/c1-21(2)22(3)10-11-23(21,19-18(22)25-15-6-4-5-7-16(15)26-19)20(29)27-17-12-13(28(30)31)8-9-14(17)24/h4-9,12H,10-11H2,1-3H3,(H,27,29) |
| InChIKey | DYXXHYXIDFUOKJ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.35 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|