C25H25N5O5 — CID 5186536
N-(4,5-dimethyl-2-nitrophenyl)-12,15,15-trimethyl-6-nitro-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10-pentaene-1-carboxamide (PubChem CID 5186536) has the molecular formula C25H25N5O5 and a molecular weight of 475.51 g/mol. Its IUPAC name is N-(4,5-dimethyl-2-nitrophenyl)-12,15,15-trimethyl-6-nitro-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10-pentaene-1-carboxamide.
| Compound Name | N-(4,5-dimethyl-2-nitrophenyl)-12,15,15-trimethyl-6-nitro-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10-pentaene-1-carboxamide |
|---|---|
| PubChem CID | 5186536 |
| Molecular Formula | C25H25N5O5 |
| Molecular Weight | 475.51 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | N-(4,5-dimethyl-2-nitrophenyl)-12,15,15-trimethyl-6-nitro-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10-pentaene-1-carboxamide |
| SMILES | Cc1cc(NC(=O)C23CCC(C)(c4nc5ccc([N+](=O)[O-])cc5nc42)C3(C)C)c([N+](=O)[O-])cc1C |
| InChI | InChI=1S/C25H25N5O5/c1-13-10-18(19(30(34)35)11-14(13)2)28-22(31)25-9-8-24(5,23(25,3)4)20-21(25)27-17-12-15(29(32)33)6-7-16(17)26-20/h6-7,10-12H,8-9H2,1-5H3,(H,28,31) |
| InChIKey | NAJGYSRMSBWVRH-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 141.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.51 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|