C24H25N5O5S — CID 5184935
12,15,15-trimethyl-N'-(4-methylphenyl)sulfonyl-6-nitro-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10-pentaene-1-carbohydrazide (PubChem CID 5184935) has the molecular formula C24H25N5O5S and a molecular weight of 495.56 g/mol. Its IUPAC name is 12,15,15-trimethyl-N'-(4-methylphenyl)sulfonyl-6-nitro-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10-pentaene-1-carbohydrazide.
| Compound Name | 12,15,15-trimethyl-N'-(4-methylphenyl)sulfonyl-6-nitro-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10-pentaene-1-carbohydrazide |
|---|---|
| PubChem CID | 5184935 |
| Molecular Formula | C24H25N5O5S |
| Molecular Weight | 495.56 g/mol |
| Exact Mass | 495.16 |
| IUPAC Name | 12,15,15-trimethyl-N'-(4-methylphenyl)sulfonyl-6-nitro-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10-pentaene-1-carbohydrazide |
| SMILES | Cc1ccc(S(=O)(=O)NNC(=O)C23CCC(C)(c4nc5ccc([N+](=O)[O-])cc5nc42)C3(C)C)cc1 |
| InChI | InChI=1S/C24H25N5O5S/c1-14-5-8-16(9-6-14)35(33,34)28-27-21(30)24-12-11-23(4,22(24,2)3)19-20(24)26-18-13-15(29(31)32)7-10-17(18)25-19/h5-10,13,28H,11-12H2,1-4H3,(H,27,30) |
| InChIKey | NCIJZUWWJHHMTD-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 144.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.56 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|