C24H23ClN4O3 — CID 5172183
N-(5-chloro-2-methylphenyl)-12,15,15-trimethyl-6-nitro-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10-pentaene-1-carboxamide (PubChem CID 5172183) has the molecular formula C24H23ClN4O3 and a molecular weight of 450.93 g/mol. Its IUPAC name is N-(5-chloro-2-methylphenyl)-12,15,15-trimethyl-6-nitro-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10-pentaene-1-carboxamide.
| Compound Name | N-(5-chloro-2-methylphenyl)-12,15,15-trimethyl-6-nitro-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10-pentaene-1-carboxamide |
|---|---|
| PubChem CID | 5172183 |
| Molecular Formula | C24H23ClN4O3 |
| Molecular Weight | 450.93 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | N-(5-chloro-2-methylphenyl)-12,15,15-trimethyl-6-nitro-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10-pentaene-1-carboxamide |
| SMILES | Cc1ccc(Cl)cc1NC(=O)C12CCC(C)(c3nc4ccc([N+](=O)[O-])cc4nc31)C2(C)C |
| InChI | InChI=1S/C24H23ClN4O3/c1-13-5-6-14(25)11-17(13)28-21(30)24-10-9-23(4,22(24,2)3)19-20(24)27-18-12-15(29(31)32)7-8-16(18)26-19/h5-8,11-12H,9-10H2,1-4H3,(H,28,30) |
| InChIKey | DSCDYABCZHTQDJ-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.93 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|