C23H19Cl4N3O — CID 3248495
6,7-dichloro-N-(2,4-dichlorophenyl)-12,15,15-trimethyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaene-1-carboxamide (PubChem CID 3248495) has the molecular formula C23H19Cl4N3O and a molecular weight of 495.24 g/mol. Its IUPAC name is 6,7-dichloro-N-(2,4-dichlorophenyl)-12,15,15-trimethyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaene-1-carboxamide.
| Compound Name | 6,7-dichloro-N-(2,4-dichlorophenyl)-12,15,15-trimethyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaene-1-carboxamide |
|---|---|
| PubChem CID | 3248495 |
| Molecular Formula | C23H19Cl4N3O |
| Molecular Weight | 495.24 g/mol |
| Exact Mass | 493.03 |
| IUPAC Name | 6,7-dichloro-N-(2,4-dichlorophenyl)-12,15,15-trimethyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaene-1-carboxamide |
| SMILES | CC12CCC(C(=O)Nc3ccc(Cl)cc3Cl)(c3nc4cc(Cl)c(Cl)cc4nc31)C2(C)C |
| InChI | InChI=1S/C23H19Cl4N3O/c1-21(2)22(3)6-7-23(21,20(31)30-15-5-4-11(24)8-14(15)27)19-18(22)28-16-9-12(25)13(26)10-17(16)29-19/h4-5,8-10H,6-7H2,1-3H3,(H,30,31) |
| InChIKey | JWAOPNXWTNHPBN-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.24 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |