C23H20Cl2N4O3 — CID 5198841
6,7-dichloro-12,15,15-trimethyl-N-(4-nitrophenyl)-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaene-1-carboxamide (PubChem CID 5198841) has the molecular formula C23H20Cl2N4O3 and a molecular weight of 471.34 g/mol. Its IUPAC name is 6,7-dichloro-12,15,15-trimethyl-N-(4-nitrophenyl)-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaene-1-carboxamide.
| Compound Name | 6,7-dichloro-12,15,15-trimethyl-N-(4-nitrophenyl)-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaene-1-carboxamide |
|---|---|
| PubChem CID | 5198841 |
| Molecular Formula | C23H20Cl2N4O3 |
| Molecular Weight | 471.34 g/mol |
| Exact Mass | 470.09 |
| IUPAC Name | 6,7-dichloro-12,15,15-trimethyl-N-(4-nitrophenyl)-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaene-1-carboxamide |
| SMILES | CC12CCC(C(=O)Nc3ccc([N+](=O)[O-])cc3)(c3nc4cc(Cl)c(Cl)cc4nc31)C2(C)C |
| InChI | InChI=1S/C23H20Cl2N4O3/c1-21(2)22(3)8-9-23(21,20(30)26-12-4-6-13(7-5-12)29(31)32)19-18(22)27-16-10-14(24)15(25)11-17(16)28-19/h4-7,10-11H,8-9H2,1-3H3,(H,26,30) |
| InChIKey | MMLBJIZHTWYHSZ-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.34 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|