C24H21Cl2N5O4 — CID 3250482
6,7-dichloro-12,15,15-trimethyl-N'-(4-nitrobenzoyl)-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaene-1-carbohydrazide (PubChem CID 3250482) has the molecular formula C24H21Cl2N5O4 and a molecular weight of 514.37 g/mol. Its IUPAC name is 6,7-dichloro-12,15,15-trimethyl-N'-(4-nitrobenzoyl)-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaene-1-carbohydrazide.
| Compound Name | 6,7-dichloro-12,15,15-trimethyl-N'-(4-nitrobenzoyl)-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaene-1-carbohydrazide |
|---|---|
| PubChem CID | 3250482 |
| Molecular Formula | C24H21Cl2N5O4 |
| Molecular Weight | 514.37 g/mol |
| Exact Mass | 513.10 |
| IUPAC Name | 6,7-dichloro-12,15,15-trimethyl-N'-(4-nitrobenzoyl)-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaene-1-carbohydrazide |
| SMILES | CC12CCC(C(=O)NNC(=O)c3ccc([N+](=O)[O-])cc3)(c3nc4cc(Cl)c(Cl)cc4nc31)C2(C)C |
| InChI | InChI=1S/C24H21Cl2N5O4/c1-22(2)23(3)8-9-24(22,19-18(23)27-16-10-14(25)15(26)11-17(16)28-19)21(33)30-29-20(32)12-4-6-13(7-5-12)31(34)35/h4-7,10-11H,8-9H2,1-3H3,(H,29,32)(H,30,33) |
| InChIKey | WCIUYZSYVPXUPC-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 127.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.37 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|