C24H22N6O6 — CID 5184746
12,15,15-trimethyl-6-nitro-N'-(4-nitrobenzoyl)-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10-pentaene-1-carbohydrazide (PubChem CID 5184746) has the molecular formula C24H22N6O6 and a molecular weight of 490.48 g/mol. Its IUPAC name is 12,15,15-trimethyl-6-nitro-N'-(4-nitrobenzoyl)-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10-pentaene-1-carbohydrazide.
| Compound Name | 12,15,15-trimethyl-6-nitro-N'-(4-nitrobenzoyl)-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10-pentaene-1-carbohydrazide |
|---|---|
| PubChem CID | 5184746 |
| Molecular Formula | C24H22N6O6 |
| Molecular Weight | 490.48 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | 12,15,15-trimethyl-6-nitro-N'-(4-nitrobenzoyl)-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10-pentaene-1-carbohydrazide |
| SMILES | CC12CCC(C(=O)NNC(=O)c3ccc([N+](=O)[O-])cc3)(c3nc4cc([N+](=O)[O-])ccc4nc31)C2(C)C |
| InChI | InChI=1S/C24H22N6O6/c1-22(2)23(3)10-11-24(22,19-18(23)25-16-9-8-15(30(35)36)12-17(16)26-19)21(32)28-27-20(31)13-4-6-14(7-5-13)29(33)34/h4-9,12H,10-11H2,1-3H3,(H,27,31)(H,28,32) |
| InChIKey | LSPHTMYXSXJOIO-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 170.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.48 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|